C29H29N3O3S — CID 145384735
N'-amino-3-[4-[[3-(2,3-dihydro-1,4-benzodioxin-5-yl)-1-benzothiophen-5-yl]methoxy]phenyl]propanimidamide;prop-1-yne (PubChem CID 145384735) has the molecular formula C29H29N3O3S and a molecular weight of 499.64 g/mol. Its IUPAC name is N'-amino-3-[4-[[3-(2,3-dihydro-1,4-benzodioxin-5-yl)-1-benzothiophen-5-yl]methoxy]phenyl]propanimidamide;prop-1-yne.
| Compound Name | N'-amino-3-[4-[[3-(2,3-dihydro-1,4-benzodioxin-5-yl)-1-benzothiophen-5-yl]methoxy]phenyl]propanimidamide;prop-1-yne |
|---|---|
| PubChem CID | 145384735 |
| Molecular Formula | C29H29N3O3S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | N'-amino-3-[4-[[3-(2,3-dihydro-1,4-benzodioxin-5-yl)-1-benzothiophen-5-yl]methoxy]phenyl]propanimidamide;prop-1-yne |
| SMILES | C#CC.N/N=C(\N)CCc1ccc(OCc2ccc3scc(-c4cccc5c4OCCO5)c3c2)cc1 |
| InChI | InChI=1S/C26H25N3O3S.C3H4/c27-25(29-28)11-7-17-4-8-19(9-5-17)32-15-18-6-10-24-21(14-18)22(16-33-24)20-2-1-3-23-26(20)31-13-12-30-23;1-3-2/h1-6,8-10,14,16H,7,11-13,15,28H2,(H2,27,29);1H,2H3 |
| InChIKey | LJENJVBEOYKPHD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|