C26H34N4OS2 — CID 145387192
ethane;N-methylsulfanylmethanamine;2-propan-2-yloxy-5-[5-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3,4-thiadiazol-2-yl]benzonitrile (PubChem CID 145387192) has the molecular formula C26H34N4OS2 and a molecular weight of 482.72 g/mol. Its IUPAC name is ethane;N-methylsulfanylmethanamine;2-propan-2-yloxy-5-[5-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3,4-thiadiazol-2-yl]benzonitrile.
| Compound Name | ethane;N-methylsulfanylmethanamine;2-propan-2-yloxy-5-[5-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3,4-thiadiazol-2-yl]benzonitrile |
|---|---|
| PubChem CID | 145387192 |
| Molecular Formula | C26H34N4OS2 |
| Molecular Weight | 482.72 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | ethane;N-methylsulfanylmethanamine;2-propan-2-yloxy-5-[5-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,3,4-thiadiazol-2-yl]benzonitrile |
| SMILES | CC.CC(C)Oc1ccc(-c2nnc(-c3cccc4c3CCCC4)s2)cc1C#N.CNSC |
| InChI | InChI=1S/C22H21N3OS.C2H7NS.C2H6/c1-14(2)26-20-11-10-16(12-17(20)13-23)21-24-25-22(27-21)19-9-5-7-15-6-3-4-8-18(15)19;1-3-4-2;1-2/h5,7,9-12,14H,3-4,6,8H2,1-2H3;3H,1-2H3;1-2H3 |
| InChIKey | HAQOJASRQIEJMG-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.72 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|