C24H23N5 — CID 145388018
5-[(2E,3Z)-2-ethylidenehexa-3,5-dienimidoyl]-4-N-(3-phenylphenyl)pyrimidine-4,6-diamine (PubChem CID 145388018) has the molecular formula C24H23N5 and a molecular weight of 381.48 g/mol. Its IUPAC name is 5-[(2E,3Z)-2-ethylidenehexa-3,5-dienimidoyl]-4-N-(3-phenylphenyl)pyrimidine-4,6-diamine.
| Compound Name | 5-[(2E,3Z)-2-ethylidenehexa-3,5-dienimidoyl]-4-N-(3-phenylphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 145388018 |
| Molecular Formula | C24H23N5 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 5-[(2E,3Z)-2-ethylidenehexa-3,5-dienimidoyl]-4-N-(3-phenylphenyl)pyrimidine-4,6-diamine |
| SMILES | [H]/N=C(C(\C=C/C=C)=C\C)/c1c(N)ncnc1Nc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C24H23N5/c1-3-5-10-17(4-2)22(25)21-23(26)27-16-28-24(21)29-20-14-9-13-19(15-20)18-11-7-6-8-12-18/h3-16,25H,1H2,2H3,(H3,26,27,28,29)/b10-5-,17-4+,25-22+ |
| InChIKey | VOLOVMZOQLGTBI-CNKQIDBUSA-N |
| XLogP | 5.53 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|