C19H15F5O3 — CID 145389470
2-[difluoro-[6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-5-methyl-1,3-dioxane (PubChem CID 145389470) has the molecular formula C19H15F5O3 and a molecular weight of 386.32 g/mol. Its IUPAC name is 2-[difluoro-[6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-5-methyl-1,3-dioxane.
| Compound Name | 2-[difluoro-[6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 145389470 |
| Molecular Formula | C19H15F5O3 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-[difluoro-[6-(3,3,3-trifluoroprop-1-ynyl)naphthalen-2-yl]oxymethyl]-5-methyl-1,3-dioxane |
| SMILES | CC1COC(C(F)(F)Oc2ccc3cc(C#CC(F)(F)F)ccc3c2)OC1 |
| InChI | InChI=1S/C19H15F5O3/c1-12-10-25-17(26-11-12)19(23,24)27-16-5-4-14-8-13(2-3-15(14)9-16)6-7-18(20,21)22/h2-5,8-9,12,17H,10-11H2,1H3 |
| InChIKey | CODXWZKSMQURIG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|