C10H18N2S — CID 145395564
3,4-bis(ethenyl)-5-ethyl-2H-1,2,5-thiadiazole;ethane (PubChem CID 145395564) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-5-ethyl-2H-1,2,5-thiadiazole;ethane.
| Compound Name | 3,4-bis(ethenyl)-5-ethyl-2H-1,2,5-thiadiazole;ethane |
|---|---|
| PubChem CID | 145395564 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 3,4-bis(ethenyl)-5-ethyl-2H-1,2,5-thiadiazole;ethane |
| SMILES | C=CC1=C(C=C)N(CC)SN1.CC |
| InChI | InChI=1S/C8H12N2S.C2H6/c1-4-7-8(5-2)10(6-3)11-9-7;1-2/h4-5,9H,1-2,6H2,3H3;1-2H3 |
| InChIKey | HCWIJGNYPYNJCE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|