C42H63N3O4 — CID 145395898
tert-butyl N-[3-[[3-[[(2E,4E)-5-(ethylamino)-3-methyl-2-[(Z)-2-methylbut-1-enyl]hexa-2,4-dienoyl]-(3-methylpentyl)amino]phenyl]methoxy]-3-phenylpropyl]-N-methylcarbamate (PubChem CID 145395898) has the molecular formula C42H63N3O4 and a molecular weight of 673.98 g/mol. Its IUPAC name is tert-butyl N-[3-[[3-[[(2E,4E)-5-(ethylamino)-3-methyl-2-[(Z)-2-methylbut-1-enyl]hexa-2,4-dienoyl]-(3-methylpentyl)amino]phenyl]methoxy]-3-phenylpropyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[[3-[[(2E,4E)-5-(ethylamino)-3-methyl-2-[(Z)-2-methylbut-1-enyl]hexa-2,4-dienoyl]-(3-methylpentyl)amino]phenyl]methoxy]-3-phenylpropyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 145395898 |
| Molecular Formula | C42H63N3O4 |
| Molecular Weight | 673.98 g/mol |
| Exact Mass | 673.48 |
| IUPAC Name | tert-butyl N-[3-[[3-[[(2E,4E)-5-(ethylamino)-3-methyl-2-[(Z)-2-methylbut-1-enyl]hexa-2,4-dienoyl]-(3-methylpentyl)amino]phenyl]methoxy]-3-phenylpropyl]-N-methylcarbamate |
| SMILES | CCN/C(C)=C/C(C)=C(\C=C(\C)CC)C(=O)N(CCC(C)CC)c1cccc(COC(CCN(C)C(=O)OC(C)(C)C)c2ccccc2)c1 |
| InChI | InChI=1S/C42H63N3O4/c1-12-31(4)23-26-45(40(46)38(27-32(5)13-2)33(6)28-34(7)43-14-3)37-22-18-19-35(29-37)30-48-39(36-20-16-15-17-21-36)24-25-44(11)41(47)49-42(8,9)10/h15-22,27-29,31,39,43H,12-14,23-26,30H2,1-11H3/b32-27-,34-28+,38-33+ |
| InChIKey | PHQQYDJRYLHJNG-XUFYGCGPSA-N |
| XLogP | 10.16 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.98 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|