About 4-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenol
4-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenol (PubChem CID 145421044) has the molecular formula C14H14O2S
and a molecular weight of 246.33 g/mol. Its IUPAC name is 4-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenol.
Molecular Properties
| Compound Name | 4-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenol |
| PubChem CID | 145421044 |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 4-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenol |
| SMILES | C=S(=O)(c1ccc(C)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H14O2S/c1-11-3-7-13(8-4-11)17(2,16)14-9-5-12(15)6-10-14/h3-10,15H,2H2,1H3 |
| InChIKey | GPUPTDGXIUNNQK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenol?
The IUPAC name of 4-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenol (CID 145421044) is 4-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenol.
What is the SMILES notation for 4-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenol?
The canonical SMILES for 4-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenol is C=S(=O)(c1ccc(C)cc1)c1ccc(O)cc1.
What is the InChIKey of 4-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenol?
The InChIKey is GPUPTDGXIUNNQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2S/c1-11-3-7-13(8-4-11)17(2,16)14-9-5-12(15)6-10-14/h3-10,15H,2H2,1H3.
What are the key properties of 4-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenol?
4-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenol has a molecular weight of 246.33 g/mol, XLogP of 2.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[methylidene-(4-methylphenyl)-oxo-λ6-sulfanyl]phenol is sourced from PubChem (CID 145421044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).