C16H24ClN3O — CID 145440918
2-(3-chloro-8-methylquinolin-6-yl)acetohydrazide;ethane (PubChem CID 145440918) has the molecular formula C16H24ClN3O and a molecular weight of 309.84 g/mol. Its IUPAC name is 2-(3-chloro-8-methylquinolin-6-yl)acetohydrazide;ethane.
| Compound Name | 2-(3-chloro-8-methylquinolin-6-yl)acetohydrazide;ethane |
|---|---|
| PubChem CID | 145440918 |
| Molecular Formula | C16H24ClN3O |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-(3-chloro-8-methylquinolin-6-yl)acetohydrazide;ethane |
| SMILES | CC.CC.Cc1cc(CC(=O)NN)cc2cc(Cl)cnc12 |
| InChI | InChI=1S/C12H12ClN3O.2C2H6/c1-7-2-8(4-11(17)16-14)3-9-5-10(13)6-15-12(7)9;2*1-2/h2-3,5-6H,4,14H2,1H3,(H,16,17);2*1-2H3 |
| InChIKey | MUIJVKGDAUEQAA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|