C34H37CoN2O2+ — CID 145474672
4-tert-butyl-2-[9-(5-tert-butyl-2-hydroxyphenyl)-10-methanidyl-1,10-phenanthrolin-10-ium-2-yl]phenol;carbanide;cobalt(2+) (PubChem CID 145474672) has the molecular formula C34H37CoN2O2+ and a molecular weight of 564.62 g/mol. Its IUPAC name is 4-tert-butyl-2-[9-(5-tert-butyl-2-hydroxyphenyl)-10-methanidyl-1,10-phenanthrolin-10-ium-2-yl]phenol;carbanide;cobalt(2+).
| Compound Name | 4-tert-butyl-2-[9-(5-tert-butyl-2-hydroxyphenyl)-10-methanidyl-1,10-phenanthrolin-10-ium-2-yl]phenol;carbanide;cobalt(2+) |
|---|---|
| PubChem CID | 145474672 |
| Molecular Formula | C34H37CoN2O2+ |
| Molecular Weight | 564.62 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 4-tert-butyl-2-[9-(5-tert-butyl-2-hydroxyphenyl)-10-methanidyl-1,10-phenanthrolin-10-ium-2-yl]phenol;carbanide;cobalt(2+) |
| SMILES | [CH2-][n+]1c(-c2cc(C(C)(C)C)ccc2O)ccc2ccc3ccc(-c4cc(C(C)(C)C)ccc4O)nc3c21.[CH3-].[Co+2] |
| InChI | InChI=1S/C33H34N2O2.CH3.Co/c1-32(2,3)22-12-16-28(36)24(18-22)26-14-10-20-8-9-21-11-15-27(35(7)31(21)30(20)34-26)25-19-23(33(4,5)6)13-17-29(25)37;;/h8-19,36-37H,7H2,1-6H3;1H3;/q;-1;+2 |
| InChIKey | PTASWIVJKVHEMM-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 57.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.62 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|