C19H17BFNO2 — CID 177421079
6-tert-butyl-1-fluoro-2,19-dioxa-18-azonia-1-boranuidapentacyclo[14.2.1.03,8.09,18.012,17]nonadeca-3(8),4,6,9(18),10,12(17),13,15-octaene (PubChem CID 177421079) has the molecular formula C19H17BFNO2 and a molecular weight of 321.16 g/mol. Its IUPAC name is 6-tert-butyl-1-fluoro-2,19-dioxa-18-azonia-1-boranuidapentacyclo[14.2.1.03,8.09,18.012,17]nonadeca-3(8),4,6,9(18),10,12(17),13,15-octaene.
| Compound Name | 6-tert-butyl-1-fluoro-2,19-dioxa-18-azonia-1-boranuidapentacyclo[14.2.1.03,8.09,18.012,17]nonadeca-3(8),4,6,9(18),10,12(17),13,15-octaene |
|---|---|
| PubChem CID | 177421079 |
| Molecular Formula | C19H17BFNO2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 6-tert-butyl-1-fluoro-2,19-dioxa-18-azonia-1-boranuidapentacyclo[14.2.1.03,8.09,18.012,17]nonadeca-3(8),4,6,9(18),10,12(17),13,15-octaene |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1ccc3cccc4c3[n+]1[B-](F)(O2)O4 |
| InChI | InChI=1S/C19H17BFNO2/c1-19(2,3)13-8-10-16-14(11-13)15-9-7-12-5-4-6-17-18(12)22(15)20(21,23-16)24-17/h4-11H,1-3H3 |
| InChIKey | UBVMPYMWHOLYIT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|