C18H23ClO3 — CID 145474854
[(4bS)-4b-(chloromethyl)-6,7,8,8a,9,10-hexahydro-5H-phenanthren-3-yl]oxymethyl acetate (PubChem CID 145474854) has the molecular formula C18H23ClO3 and a molecular weight of 322.83 g/mol. Its IUPAC name is [(4bS)-4b-(chloromethyl)-6,7,8,8a,9,10-hexahydro-5H-phenanthren-3-yl]oxymethyl acetate.
| Compound Name | [(4bS)-4b-(chloromethyl)-6,7,8,8a,9,10-hexahydro-5H-phenanthren-3-yl]oxymethyl acetate |
|---|---|
| PubChem CID | 145474854 |
| Molecular Formula | C18H23ClO3 |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [(4bS)-4b-(chloromethyl)-6,7,8,8a,9,10-hexahydro-5H-phenanthren-3-yl]oxymethyl acetate |
| SMILES | CC(=O)OCOc1ccc2c(c1)[C@]1(CCl)CCCCC1CC2 |
| InChI | InChI=1S/C18H23ClO3/c1-13(20)21-12-22-16-8-6-14-5-7-15-4-2-3-9-18(15,11-19)17(14)10-16/h6,8,10,15H,2-5,7,9,11-12H2,1H3/t15?,18-/m0/s1 |
| InChIKey | WFJMGIVJKLUBMS-PKHIMPSTSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|