C25H35NO3 — CID 145474860
[(1R,9S,10S)-10,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl cyclopentanecarboxylate (PubChem CID 145474860) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is [(1R,9S,10S)-10,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl cyclopentanecarboxylate.
| Compound Name | [(1R,9S,10S)-10,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 145474860 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | [(1R,9S,10S)-10,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl cyclopentanecarboxylate |
| SMILES | CN1CC[C@@]23CCCC[C@]2(C)[C@@H]1Cc1ccc(OCOC(=O)C2CCCC2)cc13 |
| InChI | InChI=1S/C25H35NO3/c1-24-11-5-6-12-25(24)13-14-26(2)22(24)15-19-9-10-20(16-21(19)25)28-17-29-23(27)18-7-3-4-8-18/h9-10,16,18,22H,3-8,11-15,17H2,1-2H3/t22-,24+,25+/m0/s1 |
| InChIKey | FPYFJKUZIMXIAM-ICDZXHCJSA-N |
| XLogP | 4.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|