C24H35NO4 — CID 145474865
butan-2-yl [(1R,9S,10S)-10,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl carbonate (PubChem CID 145474865) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is butan-2-yl [(1R,9S,10S)-10,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl carbonate.
| Compound Name | butan-2-yl [(1R,9S,10S)-10,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl carbonate |
|---|---|
| PubChem CID | 145474865 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | butan-2-yl [(1R,9S,10S)-10,17-dimethyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl carbonate |
| SMILES | CCC(C)OC(=O)OCOc1ccc2c(c1)[C@]13CCCC[C@]1(C)[C@H](C2)N(C)CC3 |
| InChI | InChI=1S/C24H35NO4/c1-5-17(2)29-22(26)28-16-27-19-9-8-18-14-21-23(3)10-6-7-11-24(23,20(18)15-19)12-13-25(21)4/h8-9,15,17,21H,5-7,10-14,16H2,1-4H3/t17?,21-,23+,24+/m0/s1 |
| InChIKey | OEEQHPMKRXYLJB-XMSGWFLFSA-N |
| XLogP | 5.05 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|