C16H18ClN — CID 145483316
N-[1-(2-chlorophenyl)-2-methylprop-1-enyl]-2-methylpenta-1,4-dien-3-imine (PubChem CID 145483316) has the molecular formula C16H18ClN and a molecular weight of 259.78 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)-2-methylprop-1-enyl]-2-methylpenta-1,4-dien-3-imine.
| Compound Name | N-[1-(2-chlorophenyl)-2-methylprop-1-enyl]-2-methylpenta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 145483316 |
| Molecular Formula | C16H18ClN |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | N-[1-(2-chlorophenyl)-2-methylprop-1-enyl]-2-methylpenta-1,4-dien-3-imine |
| SMILES | C=C/C(=N\C(=C(C)C)c1ccccc1Cl)C(=C)C |
| InChI | InChI=1S/C16H18ClN/c1-6-15(11(2)3)18-16(12(4)5)13-9-7-8-10-14(13)17/h6-10H,1-2H2,3-5H3/b18-15+ |
| InChIKey | BQMNKJARYCXYJF-OBGWFSINSA-N |
| XLogP | 5.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|