C21H20N2 — CID 134180301
(E)-2-N-benzhydrylidene-1-N-buta-1,3-dien-2-ylbut-2-ene-1,2-diimine (PubChem CID 134180301) has the molecular formula C21H20N2 and a molecular weight of 300.41 g/mol. Its IUPAC name is (E)-2-N-benzhydrylidene-1-N-buta-1,3-dien-2-ylbut-2-ene-1,2-diimine.
| Compound Name | (E)-2-N-benzhydrylidene-1-N-buta-1,3-dien-2-ylbut-2-ene-1,2-diimine |
|---|---|
| PubChem CID | 134180301 |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (E)-2-N-benzhydrylidene-1-N-buta-1,3-dien-2-ylbut-2-ene-1,2-diimine |
| SMILES | C=CC(=C)/N=C/C(=C\C)N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2/c1-4-17(3)22-16-20(5-2)23-21(18-12-8-6-9-13-18)19-14-10-7-11-15-19/h4-16H,1,3H2,2H3/b20-5+,22-16+ |
| InChIKey | RZEQAXXDASLFGD-NXWKQHRLSA-N |
| XLogP | 5.20 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|