C23H30ClN — CID 142919932
1-(2-chlorophenyl)-N-[(2Z,4E)-4-methyl-7-methylidene-6-propan-2-ylidenedeca-2,4-dien-3-yl]ethanimine (PubChem CID 142919932) has the molecular formula C23H30ClN and a molecular weight of 355.95 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[(2Z,4E)-4-methyl-7-methylidene-6-propan-2-ylidenedeca-2,4-dien-3-yl]ethanimine.
| Compound Name | 1-(2-chlorophenyl)-N-[(2Z,4E)-4-methyl-7-methylidene-6-propan-2-ylidenedeca-2,4-dien-3-yl]ethanimine |
|---|---|
| PubChem CID | 142919932 |
| Molecular Formula | C23H30ClN |
| Molecular Weight | 355.95 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[(2Z,4E)-4-methyl-7-methylidene-6-propan-2-ylidenedeca-2,4-dien-3-yl]ethanimine |
| SMILES | C=C(CCC)C(/C=C(C)/C(=C/C)/N=C(\C)c1ccccc1Cl)=C(C)C |
| InChI | InChI=1S/C23H30ClN/c1-8-12-17(5)21(16(3)4)15-18(6)23(9-2)25-19(7)20-13-10-11-14-22(20)24/h9-11,13-15H,5,8,12H2,1-4,6-7H3/b18-15+,23-9-,25-19+ |
| InChIKey | CDIZVMCYANKMGF-LSUPRCTKSA-N |
| XLogP | 7.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.95 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|