C24H28Cl2N3O4+ — CID 145485298
[4-chloro-2-(2-chlorobenzoyl)phenyl]-[1-hydroxy-2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]ethylidene]azanium (PubChem CID 145485298) has the molecular formula C24H28Cl2N3O4+ and a molecular weight of 493.41 g/mol. Its IUPAC name is [4-chloro-2-(2-chlorobenzoyl)phenyl]-[1-hydroxy-2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]ethylidene]azanium.
| Compound Name | [4-chloro-2-(2-chlorobenzoyl)phenyl]-[1-hydroxy-2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]ethylidene]azanium |
|---|---|
| PubChem CID | 145485298 |
| Molecular Formula | C24H28Cl2N3O4+ |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | [4-chloro-2-(2-chlorobenzoyl)phenyl]-[1-hydroxy-2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]ethylidene]azanium |
| SMILES | CC(C)(C)OC(=O)N1CCN(C/C(O)=[NH+]/c2ccc(Cl)cc2C(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C24H27Cl2N3O4/c1-24(2,3)33-23(32)29-12-10-28(11-13-29)15-21(30)27-20-9-8-16(25)14-18(20)22(31)17-6-4-5-7-19(17)26/h4-9,14H,10-13,15H2,1-3H3,(H,27,30)/p+1 |
| InChIKey | WNGVKGQFMDSJJB-UHFFFAOYSA-O |
| XLogP | 3.45 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|