C7H16N4 — CID 145488395
N,N'-diamino-2-methylcyclopentane-1-carboximidamide (PubChem CID 145488395) has the molecular formula C7H16N4 and a molecular weight of 156.23 g/mol. Its IUPAC name is N,N'-diamino-2-methylcyclopentane-1-carboximidamide.
| Compound Name | N,N'-diamino-2-methylcyclopentane-1-carboximidamide |
|---|---|
| PubChem CID | 145488395 |
| Molecular Formula | C7H16N4 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | N,N'-diamino-2-methylcyclopentane-1-carboximidamide |
| SMILES | CC1CCCC1/C(=N/N)NN |
| InChI | InChI=1S/C7H16N4/c1-5-3-2-4-6(5)7(10-8)11-9/h5-6H,2-4,8-9H2,1H3,(H,10,11) |
| InChIKey | INZZUAUVGFKJBO-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|