C20H33NO4S2 — CID 145493205
tert-butyl 2-(thiomorpholin-3-ylmethoxy)acetate;4-methoxy-2,6-dimethylbenzenethiol (PubChem CID 145493205) has the molecular formula C20H33NO4S2 and a molecular weight of 415.62 g/mol. Its IUPAC name is tert-butyl 2-(thiomorpholin-3-ylmethoxy)acetate;4-methoxy-2,6-dimethylbenzenethiol.
| Compound Name | tert-butyl 2-(thiomorpholin-3-ylmethoxy)acetate;4-methoxy-2,6-dimethylbenzenethiol |
|---|---|
| PubChem CID | 145493205 |
| Molecular Formula | C20H33NO4S2 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | tert-butyl 2-(thiomorpholin-3-ylmethoxy)acetate;4-methoxy-2,6-dimethylbenzenethiol |
| SMILES | CC(C)(C)OC(=O)COCC1CSCCN1.COc1cc(C)c(S)c(C)c1 |
| InChI | InChI=1S/C11H21NO3S.C9H12OS/c1-11(2,3)15-10(13)7-14-6-9-8-16-5-4-12-9;1-6-4-8(10-3)5-7(2)9(6)11/h9,12H,4-8H2,1-3H3;4-5,11H,1-3H3 |
| InChIKey | VQZBNBYZIFKVBF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|