C17H25F9O3 — CID 145493688
(4,4,5,5,6,6,7,7,7-nonafluoro-3-hydroxyheptyl) 4,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 145493688) has the molecular formula C17H25F9O3 and a molecular weight of 448.37 g/mol. Its IUPAC name is (4,4,5,5,6,6,7,7,7-nonafluoro-3-hydroxyheptyl) 4,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | (4,4,5,5,6,6,7,7,7-nonafluoro-3-hydroxyheptyl) 4,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 145493688 |
| Molecular Formula | C17H25F9O3 |
| Molecular Weight | 448.37 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (4,4,5,5,6,6,7,7,7-nonafluoro-3-hydroxyheptyl) 4,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)C(CC(C)(C)C)C(=O)OCCC(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H25F9O3/c1-9(2)10(8-13(3,4)5)12(28)29-7-6-11(27)14(18,19)15(20,21)16(22,23)17(24,25)26/h9-11,27H,6-8H2,1-5H3 |
| InChIKey | AOFGMOLVXMHHQS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.37 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|