C20H34N2 — CID 145498119
ethane;(4E)-4-ethyl-N-[(2Z,5Z)-4-iminohepta-2,5-dien-3-yl]-7-methylocta-4,6-dien-3-imine (PubChem CID 145498119) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is ethane;(4E)-4-ethyl-N-[(2Z,5Z)-4-iminohepta-2,5-dien-3-yl]-7-methylocta-4,6-dien-3-imine.
| Compound Name | ethane;(4E)-4-ethyl-N-[(2Z,5Z)-4-iminohepta-2,5-dien-3-yl]-7-methylocta-4,6-dien-3-imine |
|---|---|
| PubChem CID | 145498119 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | ethane;(4E)-4-ethyl-N-[(2Z,5Z)-4-iminohepta-2,5-dien-3-yl]-7-methylocta-4,6-dien-3-imine |
| SMILES | CC.[H]/N=C(\C=C/C)C(=C/C)/N=C(CC)\C(=C\C=C(C)C)CC |
| InChI | InChI=1S/C18H28N2.C2H6/c1-7-11-16(19)18(10-4)20-17(9-3)15(8-2)13-12-14(5)6;1-2/h7,10-13,19H,8-9H2,1-6H3;1-2H3/b11-7-,15-13+,18-10-,19-16+,20-17+; |
| InChIKey | LSIOMBPULXXSFD-DHAXHOKWSA-N |
| XLogP | 6.67 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|