C13H22Cl2N2Pt — CID 14577046
dichloroplatinum;3-ethyl-1-phenylpentane-2,3-diamine (PubChem CID 14577046) has the molecular formula C13H22Cl2N2Pt and a molecular weight of 472.32 g/mol. Its IUPAC name is dichloroplatinum;3-ethyl-1-phenylpentane-2,3-diamine.
| Compound Name | dichloroplatinum;3-ethyl-1-phenylpentane-2,3-diamine |
|---|---|
| PubChem CID | 14577046 |
| Molecular Formula | C13H22Cl2N2Pt |
| Molecular Weight | 472.32 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | dichloroplatinum;3-ethyl-1-phenylpentane-2,3-diamine |
| SMILES | CCC(N)(CC)C(N)Cc1ccccc1.Cl[Pt]Cl |
| InChI | InChI=1S/C13H22N2.2ClH.Pt/c1-3-13(15,4-2)12(14)10-11-8-6-5-7-9-11;;;/h5-9,12H,3-4,10,14-15H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | MXMRXJSBWLOPIV-UHFFFAOYSA-L |
| XLogP | 3.45 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |