C13H9BrF2OZn — CID 146002338
bromozinc(1+);1,3-difluoro-2-(phenylmethoxy)benzene (PubChem CID 146002338) has the molecular formula C13H9BrF2OZn and a molecular weight of 364.50 g/mol. Its IUPAC name is bromozinc(1+);1,3-difluoro-2-(phenylmethoxy)benzene.
| Compound Name | bromozinc(1+);1,3-difluoro-2-(phenylmethoxy)benzene |
|---|---|
| PubChem CID | 146002338 |
| Molecular Formula | C13H9BrF2OZn |
| Molecular Weight | 364.50 g/mol |
| Exact Mass | 361.91 |
| IUPAC Name | bromozinc(1+);1,3-difluoro-2-(phenylmethoxy)benzene |
| SMILES | Fc1cccc(F)c1OCc1[c-]cccc1.[Zn+]Br |
| InChI | InChI=1S/C13H9F2O.BrH.Zn/c14-11-7-4-8-12(15)13(11)16-9-10-5-2-1-3-6-10;;/h1-5,7-8H,9H2;1H;/q-1;;+2/p-1 |
| InChIKey | SOSFDYSZMFPKFI-UHFFFAOYSA-M |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|