C19H26O9S — CID 146028794
[(2R,3S,4S)-4-acetyloxy-2-[(1S)-1-methylsulfonyloxyethyl]-3-phenylmethoxyoxolan-2-yl]methyl acetate (PubChem CID 146028794) has the molecular formula C19H26O9S and a molecular weight of 430.48 g/mol. Its IUPAC name is [(2R,3S,4S)-4-acetyloxy-2-[(1S)-1-methylsulfonyloxyethyl]-3-phenylmethoxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S)-4-acetyloxy-2-[(1S)-1-methylsulfonyloxyethyl]-3-phenylmethoxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 146028794 |
| Molecular Formula | C19H26O9S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | [(2R,3S,4S)-4-acetyloxy-2-[(1S)-1-methylsulfonyloxyethyl]-3-phenylmethoxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]1([C@H](C)OS(C)(=O)=O)OC[C@H](OC(C)=O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H26O9S/c1-13(28-29(4,22)23)19(12-25-14(2)20)18(17(11-26-19)27-15(3)21)24-10-16-8-6-5-7-9-16/h5-9,13,17-18H,10-12H2,1-4H3/t13-,17-,18-,19-/m0/s1 |
| InChIKey | OLTGCSKNLYWTFJ-VKOGCVSHSA-N |
| XLogP | 1.20 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|