C25H31O9P — CID 101272986
[(3S,4S,5S)-5-acetyloxy-2-hydroxy-1-methoxy-1-oxo-3,4-bis(phenylmethoxy)-1λ5-phosphinan-2-yl]methyl acetate (PubChem CID 101272986) has the molecular formula C25H31O9P and a molecular weight of 506.49 g/mol. Its IUPAC name is [(3S,4S,5S)-5-acetyloxy-2-hydroxy-1-methoxy-1-oxo-3,4-bis(phenylmethoxy)-1λ5-phosphinan-2-yl]methyl acetate.
| Compound Name | [(3S,4S,5S)-5-acetyloxy-2-hydroxy-1-methoxy-1-oxo-3,4-bis(phenylmethoxy)-1λ5-phosphinan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101272986 |
| Molecular Formula | C25H31O9P |
| Molecular Weight | 506.49 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | [(3S,4S,5S)-5-acetyloxy-2-hydroxy-1-methoxy-1-oxo-3,4-bis(phenylmethoxy)-1λ5-phosphinan-2-yl]methyl acetate |
| SMILES | COP1(=O)C[C@@H](OC(C)=O)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)C1(O)COC(C)=O |
| InChI | InChI=1S/C25H31O9P/c1-18(26)33-17-25(28)24(32-15-21-12-8-5-9-13-21)23(31-14-20-10-6-4-7-11-20)22(34-19(2)27)16-35(25,29)30-3/h4-13,22-24,28H,14-17H2,1-3H3/t22-,23+,24+,25?,35?/m1/s1 |
| InChIKey | KJDYKMYAUXBACJ-WVENYRNHSA-N |
| XLogP | 3.28 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|