C45H72N2O3SiSn — CID 146029863
(2S)-N-[(1Z,4S,6Z)-4-[tert-butyl(diphenyl)silyl]oxyocta-1,6-dienyl]-3,3-dimethyl-2-[[(Z)-3-tributylstannylprop-2-enoyl]amino]butanamide (PubChem CID 146029863) has the molecular formula C45H72N2O3SiSn and a molecular weight of 835.88 g/mol. Its IUPAC name is (2S)-N-[(1Z,4S,6Z)-4-[tert-butyl(diphenyl)silyl]oxyocta-1,6-dienyl]-3,3-dimethyl-2-[[(Z)-3-tributylstannylprop-2-enoyl]amino]butanamide.
| Compound Name | (2S)-N-[(1Z,4S,6Z)-4-[tert-butyl(diphenyl)silyl]oxyocta-1,6-dienyl]-3,3-dimethyl-2-[[(Z)-3-tributylstannylprop-2-enoyl]amino]butanamide |
|---|---|
| PubChem CID | 146029863 |
| Molecular Formula | C45H72N2O3SiSn |
| Molecular Weight | 835.88 g/mol |
| Exact Mass | 836.43 |
| IUPAC Name | (2S)-N-[(1Z,4S,6Z)-4-[tert-butyl(diphenyl)silyl]oxyocta-1,6-dienyl]-3,3-dimethyl-2-[[(Z)-3-tributylstannylprop-2-enoyl]amino]butanamide |
| SMILES | C/C=C\C[C@@H](C/C=C\NC(=O)[C@@H](NC(=O)/C=C\[Sn](CCCC)(CCCC)CCCC)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H45N2O3Si.3C4H9.Sn/c1-9-11-19-26(20-18-25-34-31(37)30(32(3,4)5)35-29(36)10-2)38-39(33(6,7)8,27-21-14-12-15-22-27)28-23-16-13-17-24-28;3*1-3-4-2;/h2,9-18,21-26,30H,19-20H2,1,3-8H3,(H,34,37)(H,35,36);3*1,3-4H2,2H3;/b10-2?,11-9-,25-18-;;;;/t26-,30+;;;;/m0..../s1 |
| InChIKey | FFSNRWZJXNOYBL-ZCAVDHQLSA-N |
| XLogP | 10.39 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.88 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|