C34H45NO3Si — CID 58139546
N-[(3S,6Z,9S,11Z)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]prop-2-ynamide (PubChem CID 58139546) has the molecular formula C34H45NO3Si and a molecular weight of 543.82 g/mol. Its IUPAC name is N-[(3S,6Z,9S,11Z)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]prop-2-ynamide.
| Compound Name | N-[(3S,6Z,9S,11Z)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]prop-2-ynamide |
|---|---|
| PubChem CID | 58139546 |
| Molecular Formula | C34H45NO3Si |
| Molecular Weight | 543.82 g/mol |
| Exact Mass | 543.32 |
| IUPAC Name | N-[(3S,6Z,9S,11Z)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]prop-2-ynamide |
| SMILES | C#CC(=O)N[C@H](C(=O)C/C=C\C[C@H](C/C=C\C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C34H45NO3Si/c1-9-11-20-27(21-18-19-26-30(36)32(33(3,4)5)35-31(37)10-2)38-39(34(6,7)8,28-22-14-12-15-23-28)29-24-16-13-17-25-29/h2,9,11-19,22-25,27,32H,20-21,26H2,1,3-8H3,(H,35,37)/b11-9-,19-18-/t27-,32+/m0/s1 |
| InChIKey | JTHBYAPGLXAYMY-IJQFLDCASA-N |
| XLogP | 5.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.82 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|