C36H47NO3Si — CID 58139572
(E)-N-[(3S,6Z,9S,11Z)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]pent-2-en-4-ynamide (PubChem CID 58139572) has the molecular formula C36H47NO3Si and a molecular weight of 569.86 g/mol. Its IUPAC name is (E)-N-[(3S,6Z,9S,11Z)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]pent-2-en-4-ynamide.
| Compound Name | (E)-N-[(3S,6Z,9S,11Z)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]pent-2-en-4-ynamide |
|---|---|
| PubChem CID | 58139572 |
| Molecular Formula | C36H47NO3Si |
| Molecular Weight | 569.86 g/mol |
| Exact Mass | 569.33 |
| IUPAC Name | (E)-N-[(3S,6Z,9S,11Z)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]pent-2-en-4-ynamide |
| SMILES | C#C/C=C/C(=O)N[C@H](C(=O)C/C=C\C[C@H](C/C=C\C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C36H47NO3Si/c1-9-11-21-29(22-19-20-27-32(38)34(35(3,4)5)37-33(39)28-12-10-2)40-41(36(6,7)8,30-23-15-13-16-24-30)31-25-17-14-18-26-31/h2,9,11-20,23-26,28-29,34H,21-22,27H2,1,3-8H3,(H,37,39)/b11-9-,20-19-,28-12+/t29-,34+/m0/s1 |
| InChIKey | KQGMZERFVJSROV-MXCKMIMRSA-N |
| XLogP | 6.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.86 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|