C35H47NO3Si — CID 58139614
(Z)-N-[(Z,3S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotridec-6-en-11-yn-3-yl]but-2-enamide (PubChem CID 58139614) has the molecular formula C35H47NO3Si and a molecular weight of 557.85 g/mol. Its IUPAC name is (Z)-N-[(Z,3S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotridec-6-en-11-yn-3-yl]but-2-enamide.
| Compound Name | (Z)-N-[(Z,3S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotridec-6-en-11-yn-3-yl]but-2-enamide |
|---|---|
| PubChem CID | 58139614 |
| Molecular Formula | C35H47NO3Si |
| Molecular Weight | 557.85 g/mol |
| Exact Mass | 557.33 |
| IUPAC Name | (Z)-N-[(Z,3S,9R)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotridec-6-en-11-yn-3-yl]but-2-enamide |
| SMILES | CC#CC[C@@H](C/C=C\CC(=O)[C@@H](NC(=O)/C=C\C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H47NO3Si/c1-9-11-21-28(22-18-19-27-31(37)33(34(3,4)5)36-32(38)20-10-2)39-40(35(6,7)8,29-23-14-12-15-24-29)30-25-16-13-17-26-30/h10,12-20,23-26,28,33H,21-22,27H2,1-8H3,(H,36,38)/b19-18-,20-10-/t28-,33+/m0/s1 |
| InChIKey | LGGKJCQNOAMFDA-KYQMFXCLSA-N |
| XLogP | 6.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.85 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|