C34H46INO3Si — CID 58139517
(Z)-N-[(3S,6Z,9S,11Z)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]-3-iodoprop-2-enamide (PubChem CID 58139517) has the molecular formula C34H46INO3Si and a molecular weight of 671.74 g/mol. Its IUPAC name is (Z)-N-[(3S,6Z,9S,11Z)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]-3-iodoprop-2-enamide.
| Compound Name | (Z)-N-[(3S,6Z,9S,11Z)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]-3-iodoprop-2-enamide |
|---|---|
| PubChem CID | 58139517 |
| Molecular Formula | C34H46INO3Si |
| Molecular Weight | 671.74 g/mol |
| Exact Mass | 671.23 |
| IUPAC Name | (Z)-N-[(3S,6Z,9S,11Z)-9-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-4-oxotrideca-6,11-dien-3-yl]-3-iodoprop-2-enamide |
| SMILES | C/C=C\C[C@@H](C/C=C\CC(=O)[C@@H](NC(=O)/C=C\I)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H46INO3Si/c1-8-9-18-27(19-16-17-24-30(37)32(33(2,3)4)36-31(38)25-26-35)39-40(34(5,6)7,28-20-12-10-13-21-28)29-22-14-11-15-23-29/h8-17,20-23,25-27,32H,18-19,24H2,1-7H3,(H,36,38)/b9-8-,17-16-,26-25-/t27-,32+/m0/s1 |
| InChIKey | HMCWGBNPZUKUBT-DZEBANLXSA-N |
| XLogP | 7.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.74 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|