C22H27N7O3 — CID 146047315
6-[[4-[2-methoxy-4-(methoxymethyl)anilino]-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-2-carbonitrile (PubChem CID 146047315) has the molecular formula C22H27N7O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 6-[[4-[2-methoxy-4-(methoxymethyl)anilino]-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-2-carbonitrile.
| Compound Name | 6-[[4-[2-methoxy-4-(methoxymethyl)anilino]-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 146047315 |
| Molecular Formula | C22H27N7O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 6-[[4-[2-methoxy-4-(methoxymethyl)anilino]-2-methyl-3-oxo-3a,4,5,6,7,7a-hexahydro-1H-pyrazolo[3,4-b]pyridin-6-yl]amino]pyridine-2-carbonitrile |
| SMILES | COCc1ccc(NC2CC(Nc3cccc(C#N)n3)NC3NN(C)C(=O)C23)c(OC)c1 |
| InChI | InChI=1S/C22H27N7O3/c1-29-22(30)20-16(25-15-8-7-13(12-31-2)9-17(15)32-3)10-19(27-21(20)28-29)26-18-6-4-5-14(11-23)24-18/h4-9,16,19-21,25,27-28H,10,12H2,1-3H3,(H,24,26) |
| InChIKey | PRWJHKFMMYBOLQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |