C31H30F3N2O3- — CID 146047756
(3S)-3-[4-[[4-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]phenyl]methoxy]phenyl]hex-4-ynoate (PubChem CID 146047756) has the molecular formula C31H30F3N2O3- and a molecular weight of 535.59 g/mol. Its IUPAC name is (3S)-3-[4-[[4-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]phenyl]methoxy]phenyl]hex-4-ynoate.
| Compound Name | (3S)-3-[4-[[4-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]phenyl]methoxy]phenyl]hex-4-ynoate |
|---|---|
| PubChem CID | 146047756 |
| Molecular Formula | C31H30F3N2O3- |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | (3S)-3-[4-[[4-[[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]phenyl]methoxy]phenyl]hex-4-ynoate |
| SMILES | CC#C[C@@H](CC(=O)[O-])c1ccc(OCc2ccc(CN3CCN(c4ccc(C(F)(F)F)cc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C31H31F3N2O3/c1-2-3-26(20-30(37)38)25-8-14-29(15-9-25)39-22-24-6-4-23(5-7-24)21-35-16-18-36(19-17-35)28-12-10-27(11-13-28)31(32,33)34/h4-15,26H,16-22H2,1H3,(H,37,38)/p-1/t26-/m0/s1 |
| InChIKey | HXBHDQRSGAFFQN-SANMLTNESA-M |
| XLogP | 4.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|