C18H28N2O4S2 — CID 146091055
2-acetamido-N-(2-tert-butylsulfanylethyl)-2-(4-methylsulfonylphenyl)propanamide (PubChem CID 146091055) has the molecular formula C18H28N2O4S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 2-acetamido-N-(2-tert-butylsulfanylethyl)-2-(4-methylsulfonylphenyl)propanamide.
| Compound Name | 2-acetamido-N-(2-tert-butylsulfanylethyl)-2-(4-methylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 146091055 |
| Molecular Formula | C18H28N2O4S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 2-acetamido-N-(2-tert-butylsulfanylethyl)-2-(4-methylsulfonylphenyl)propanamide |
| SMILES | CC(=O)NC(C)(C(=O)NCCSC(C)(C)C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H28N2O4S2/c1-13(21)20-18(5,16(22)19-11-12-25-17(2,3)4)14-7-9-15(10-8-14)26(6,23)24/h7-10H,11-12H2,1-6H3,(H,19,22)(H,20,21) |
| InChIKey | CVVBLTIKEMXROY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|