C12H14FNO2 — CID 146120728
[(3S,3aS,9bR)-8-fluoro-1,2,3,3a,4,9b-hexahydrochromeno[4,3-b]pyrrol-3-yl]methanol (PubChem CID 146120728) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is [(3S,3aS,9bR)-8-fluoro-1,2,3,3a,4,9b-hexahydrochromeno[4,3-b]pyrrol-3-yl]methanol.
| Compound Name | [(3S,3aS,9bR)-8-fluoro-1,2,3,3a,4,9b-hexahydrochromeno[4,3-b]pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 146120728 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | [(3S,3aS,9bR)-8-fluoro-1,2,3,3a,4,9b-hexahydrochromeno[4,3-b]pyrrol-3-yl]methanol |
| SMILES | OC[C@@H]1CN[C@H]2c3cc(F)ccc3OC[C@@H]12 |
| InChI | InChI=1S/C12H14FNO2/c13-8-1-2-11-9(3-8)12-10(6-16-11)7(5-15)4-14-12/h1-3,7,10,12,14-15H,4-6H2/t7-,10-,12-/m0/s1 |
| InChIKey | TWOMEZAQAPBQRB-JWYUURKGSA-N |
| XLogP | 1.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |