C6H8BNO2S — CID 146160593
(2-cyclopropyl-1,3-thiazol-4-yl)boronic acid (PubChem CID 146160593) has the molecular formula C6H8BNO2S and a molecular weight of 169.01 g/mol. Its IUPAC name is (2-cyclopropyl-1,3-thiazol-4-yl)boronic acid.
| Compound Name | (2-cyclopropyl-1,3-thiazol-4-yl)boronic acid |
|---|---|
| PubChem CID | 146160593 |
| Molecular Formula | C6H8BNO2S |
| Molecular Weight | 169.01 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | (2-cyclopropyl-1,3-thiazol-4-yl)boronic acid |
| SMILES | OB(O)c1csc(C2CC2)n1 |
| InChI | InChI=1S/C6H8BNO2S/c9-7(10)5-3-11-6(8-5)4-1-2-4/h3-4,9-10H,1-2H2 |
| InChIKey | CSXDLTIJRMQZNZ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.01 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|