C7H4BrO+ — CID 146163979
6-bromocyclohexa-1,3,5-triene-1-carbaldehyde (PubChem CID 146163979) has the molecular formula C7H4BrO+ and a molecular weight of 184.01 g/mol. Its IUPAC name is 6-bromocyclohexa-1,3,5-triene-1-carbaldehyde.
| Compound Name | 6-bromocyclohexa-1,3,5-triene-1-carbaldehyde |
|---|---|
| PubChem CID | 146163979 |
| Molecular Formula | C7H4BrO+ |
| Molecular Weight | 184.01 g/mol |
| Exact Mass | 182.94 |
| IUPAC Name | 6-bromocyclohexa-1,3,5-triene-1-carbaldehyde |
| SMILES | O=CC1=CC=C[C+]=C1Br |
| InChI | InChI=1S/C7H4BrO/c8-7-4-2-1-3-6(7)5-9/h1-3,5H/q+1 |
| InChIKey | KDLAJSBQRQHOAQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.01 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|