C21H25NO — CID 146164940
(1S)-10,10-dimethyl-6-(2-phenylmethoxyethyl)-4-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene (PubChem CID 146164940) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is (1S)-10,10-dimethyl-6-(2-phenylmethoxyethyl)-4-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene.
| Compound Name | (1S)-10,10-dimethyl-6-(2-phenylmethoxyethyl)-4-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 146164940 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (1S)-10,10-dimethyl-6-(2-phenylmethoxyethyl)-4-azatricyclo[7.1.1.02,7]undeca-2(7),3,5-triene |
| SMILES | CC1(C)C2Cc3c(CCOCc4ccccc4)cncc3[C@H]1C2 |
| InChI | InChI=1S/C21H25NO/c1-21(2)17-10-18-16(12-22-13-19(18)20(21)11-17)8-9-23-14-15-6-4-3-5-7-15/h3-7,12-13,17,20H,8-11,14H2,1-2H3/t17?,20-/m1/s1 |
| InChIKey | BKCYXJPKZOXIBM-UUSAFJCLSA-N |
| XLogP | 4.53 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|