C18H20O5 — CID 146167038
(4-methoxyphenyl)methyl (3aS,4R)-4-methyl-3-oxo-1,3a,5,7a-tetrahydro-2-benzofuran-4-carboxylate (PubChem CID 146167038) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (3aS,4R)-4-methyl-3-oxo-1,3a,5,7a-tetrahydro-2-benzofuran-4-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (3aS,4R)-4-methyl-3-oxo-1,3a,5,7a-tetrahydro-2-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 146167038 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (4-methoxyphenyl)methyl (3aS,4R)-4-methyl-3-oxo-1,3a,5,7a-tetrahydro-2-benzofuran-4-carboxylate |
| SMILES | COc1ccc(COC(=O)[C@]2(C)CC=CC3COC(=O)[C@@H]32)cc1 |
| InChI | InChI=1S/C18H20O5/c1-18(9-3-4-13-11-22-16(19)15(13)18)17(20)23-10-12-5-7-14(21-2)8-6-12/h3-8,13,15H,9-11H2,1-2H3/t13?,15-,18-/m1/s1 |
| InChIKey | RUSVKGMGJMSJBG-HQKHBYFDSA-N |
| XLogP | 2.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|