C23H34N2O6Si — CID 146167237
4-O-ethyl 1-O-methyl 3-diazo-2-(3-methylidene-5-phenylmethoxypentyl)-2-trimethylsilyloxybutanedioate (PubChem CID 146167237) has the molecular formula C23H34N2O6Si and a molecular weight of 462.62 g/mol. Its IUPAC name is 4-O-ethyl 1-O-methyl 3-diazo-2-(3-methylidene-5-phenylmethoxypentyl)-2-trimethylsilyloxybutanedioate.
| Compound Name | 4-O-ethyl 1-O-methyl 3-diazo-2-(3-methylidene-5-phenylmethoxypentyl)-2-trimethylsilyloxybutanedioate |
|---|---|
| PubChem CID | 146167237 |
| Molecular Formula | C23H34N2O6Si |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 4-O-ethyl 1-O-methyl 3-diazo-2-(3-methylidene-5-phenylmethoxypentyl)-2-trimethylsilyloxybutanedioate |
| SMILES | C=C(CCOCc1ccccc1)CCC(O[Si](C)(C)C)(C(=O)OC)C(=[N+]=[N-])C(=O)OCC |
| InChI | InChI=1S/C23H34N2O6Si/c1-7-30-21(26)20(25-24)23(22(27)28-3,31-32(4,5)6)15-13-18(2)14-16-29-17-19-11-9-8-10-12-19/h8-12H,2,7,13-17H2,1,3-6H3 |
| InChIKey | SQIQVRDRWWBLBM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 107.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|