C24H36N2O7Si — CID 155931202
dimethyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-diazo-2-(3-oxo-5-phenylmethoxypentyl)butanedioate (PubChem CID 155931202) has the molecular formula C24H36N2O7Si and a molecular weight of 492.65 g/mol. Its IUPAC name is dimethyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-diazo-2-(3-oxo-5-phenylmethoxypentyl)butanedioate.
| Compound Name | dimethyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-diazo-2-(3-oxo-5-phenylmethoxypentyl)butanedioate |
|---|---|
| PubChem CID | 155931202 |
| Molecular Formula | C24H36N2O7Si |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | dimethyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-diazo-2-(3-oxo-5-phenylmethoxypentyl)butanedioate |
| SMILES | COC(=O)C(=[N+]=[N-])[C@@](CCC(=O)CCOCc1ccccc1)(O[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C24H36N2O7Si/c1-23(2,3)34(6,7)33-24(22(29)31-5,20(26-25)21(28)30-4)15-13-19(27)14-16-32-17-18-11-9-8-10-12-18/h8-12H,13-17H2,1-7H3/t24-/m1/s1 |
| InChIKey | ARCUCVFRQSMOIZ-XMMPIXPASA-N |
| XLogP | 3.72 |
| TPSA | 124.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|