C29H44N2O6Si — CID 155932396
dimethyl (2R)-3-diazo-2-[(E,8R)-6,8-dimethyl-3-oxo-9-phenylnon-6-enyl]-2-triethylsilyloxybutanedioate (PubChem CID 155932396) has the molecular formula C29H44N2O6Si and a molecular weight of 544.77 g/mol. Its IUPAC name is dimethyl (2R)-3-diazo-2-[(E,8R)-6,8-dimethyl-3-oxo-9-phenylnon-6-enyl]-2-triethylsilyloxybutanedioate.
| Compound Name | dimethyl (2R)-3-diazo-2-[(E,8R)-6,8-dimethyl-3-oxo-9-phenylnon-6-enyl]-2-triethylsilyloxybutanedioate |
|---|---|
| PubChem CID | 155932396 |
| Molecular Formula | C29H44N2O6Si |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | dimethyl (2R)-3-diazo-2-[(E,8R)-6,8-dimethyl-3-oxo-9-phenylnon-6-enyl]-2-triethylsilyloxybutanedioate |
| SMILES | CC[Si](CC)(CC)O[C@@](CCC(=O)CC/C(C)=C/[C@H](C)Cc1ccccc1)(C(=O)OC)C(=[N+]=[N-])C(=O)OC |
| InChI | InChI=1S/C29H44N2O6Si/c1-8-38(9-2,10-3)37-29(28(34)36-7,26(31-30)27(33)35-6)19-18-25(32)17-16-22(4)20-23(5)21-24-14-12-11-13-15-24/h11-15,20,23H,8-10,16-19,21H2,1-7H3/b22-20+/t23-,29+/m0/s1 |
| InChIKey | ZYVIPSZPNGHSQH-OLCLTPOKSA-N |
| XLogP | 5.72 |
| TPSA | 115.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|