C22H32N2O7Si — CID 146167239
4-O-ethyl 1-O-methyl 3-diazo-2-(3-oxo-5-phenylmethoxypentyl)-2-trimethylsilyloxybutanedioate (PubChem CID 146167239) has the molecular formula C22H32N2O7Si and a molecular weight of 464.59 g/mol. Its IUPAC name is 4-O-ethyl 1-O-methyl 3-diazo-2-(3-oxo-5-phenylmethoxypentyl)-2-trimethylsilyloxybutanedioate.
| Compound Name | 4-O-ethyl 1-O-methyl 3-diazo-2-(3-oxo-5-phenylmethoxypentyl)-2-trimethylsilyloxybutanedioate |
|---|---|
| PubChem CID | 146167239 |
| Molecular Formula | C22H32N2O7Si |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 4-O-ethyl 1-O-methyl 3-diazo-2-(3-oxo-5-phenylmethoxypentyl)-2-trimethylsilyloxybutanedioate |
| SMILES | CCOC(=O)C(=[N+]=[N-])C(CCC(=O)CCOCc1ccccc1)(O[Si](C)(C)C)C(=O)OC |
| InChI | InChI=1S/C22H32N2O7Si/c1-6-30-20(26)19(24-23)22(21(27)28-2,31-32(3,4)5)14-12-18(25)13-15-29-16-17-10-8-7-9-11-17/h7-11H,6,12-16H2,1-5H3 |
| InChIKey | YVFXFTUIWLUBFR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 124.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|