C25H38N2O6Si — CID 155931926
dimethyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-diazo-2-(3-methylidene-5-phenylmethoxypentyl)butanedioate (PubChem CID 155931926) has the molecular formula C25H38N2O6Si and a molecular weight of 490.67 g/mol. Its IUPAC name is dimethyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-diazo-2-(3-methylidene-5-phenylmethoxypentyl)butanedioate.
| Compound Name | dimethyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-diazo-2-(3-methylidene-5-phenylmethoxypentyl)butanedioate |
|---|---|
| PubChem CID | 155931926 |
| Molecular Formula | C25H38N2O6Si |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | dimethyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-3-diazo-2-(3-methylidene-5-phenylmethoxypentyl)butanedioate |
| SMILES | C=C(CCOCc1ccccc1)CC[C@](O[Si](C)(C)C(C)(C)C)(C(=O)OC)C(=[N+]=[N-])C(=O)OC |
| InChI | InChI=1S/C25H38N2O6Si/c1-19(15-17-32-18-20-12-10-9-11-13-20)14-16-25(23(29)31-6,21(27-26)22(28)30-5)33-34(7,8)24(2,3)4/h9-13H,1,14-18H2,2-8H3/t25-/m1/s1 |
| InChIKey | KRYHUQKQDSRUAQ-RUZDIDTESA-N |
| XLogP | 4.71 |
| TPSA | 107.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|