C10H17N3O3S2 — CID 146212896
5-[(3aS,4S,6aR)-5,5-dioxo-2-sulfanylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide (PubChem CID 146212896) has the molecular formula C10H17N3O3S2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-5,5-dioxo-2-sulfanylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide.
| Compound Name | 5-[(3aS,4S,6aR)-5,5-dioxo-2-sulfanylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide |
|---|---|
| PubChem CID | 146212896 |
| Molecular Formula | C10H17N3O3S2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 5-[(3aS,4S,6aR)-5,5-dioxo-2-sulfanylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide |
| SMILES | NC(=O)CCCC[C@H]1[C@H]2NC(=S)N[C@H]2CS1(=O)=O |
| InChI | InChI=1S/C10H17N3O3S2/c11-8(14)4-2-1-3-7-9-6(5-18(7,15)16)12-10(17)13-9/h6-7,9H,1-5H2,(H2,11,14)(H2,12,13,17)/t6-,7-,9-/m0/s1 |
| InChIKey | IUDATXKRGBKRFI-ZKWXMUAHSA-N |
| XLogP | -0.96 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|