C7H6Cl2N2 — CID 146217171
2,6-dichloro-5,7-dihydropyrrolo[3,4-b]pyridine (PubChem CID 146217171) has the molecular formula C7H6Cl2N2 and a molecular weight of 189.05 g/mol. Its IUPAC name is 2,6-dichloro-5,7-dihydropyrrolo[3,4-b]pyridine.
| Compound Name | 2,6-dichloro-5,7-dihydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 146217171 |
| Molecular Formula | C7H6Cl2N2 |
| Molecular Weight | 189.05 g/mol |
| Exact Mass | 187.99 |
| IUPAC Name | 2,6-dichloro-5,7-dihydropyrrolo[3,4-b]pyridine |
| SMILES | Clc1ccc2c(n1)CN(Cl)C2 |
| InChI | InChI=1S/C7H6Cl2N2/c8-7-2-1-5-3-11(9)4-6(5)10-7/h1-2H,3-4H2 |
| InChIKey | KHYGTHXXRBXEME-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.05 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|