C29H33N3O3 — CID 146217416
[(1R,2S,3S,6R,9S,10R)-20-(cyclopropylmethyl)-3-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12,14,16-trien-5-yl]-(1-oxidopyridin-1-ium-3-yl)methanone (PubChem CID 146217416) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is [(1R,2S,3S,6R,9S,10R)-20-(cyclopropylmethyl)-3-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12,14,16-trien-5-yl]-(1-oxidopyridin-1-ium-3-yl)methanone.
| Compound Name | [(1R,2S,3S,6R,9S,10R)-20-(cyclopropylmethyl)-3-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12,14,16-trien-5-yl]-(1-oxidopyridin-1-ium-3-yl)methanone |
|---|---|
| PubChem CID | 146217416 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | [(1R,2S,3S,6R,9S,10R)-20-(cyclopropylmethyl)-3-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12,14,16-trien-5-yl]-(1-oxidopyridin-1-ium-3-yl)methanone |
| SMILES | O=C(c1ccc[n+]([O-])c1)N1C[C@]2(O)C[C@@]34CC[C@@H]1[C@@H]2[C@@]31CCN(CC2CC2)[C@@H]4Cc2ccccc21 |
| InChI | InChI=1S/C29H33N3O3/c33-26(21-5-3-12-31(35)16-21)32-18-28(34)17-27-10-9-23(32)25(28)29(27)11-13-30(15-19-7-8-19)24(27)14-20-4-1-2-6-22(20)29/h1-6,12,16,19,23-25,34H,7-11,13-15,17-18H2/t23-,24-,25+,27-,28-,29+/m1/s1 |
| InChIKey | GWJRPHSPHAWHPM-KSYWJSFZSA-N |
| XLogP | 2.65 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|