C18H27N3O7S — CID 146221367
6-[[4-propan-2-yl-6-(2-sulfoethylcarbamoyl)pyridine-2-carbonyl]amino]hexanoic acid (PubChem CID 146221367) has the molecular formula C18H27N3O7S and a molecular weight of 429.50 g/mol. Its IUPAC name is 6-[[4-propan-2-yl-6-(2-sulfoethylcarbamoyl)pyridine-2-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[4-propan-2-yl-6-(2-sulfoethylcarbamoyl)pyridine-2-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 146221367 |
| Molecular Formula | C18H27N3O7S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 6-[[4-propan-2-yl-6-(2-sulfoethylcarbamoyl)pyridine-2-carbonyl]amino]hexanoic acid |
| SMILES | CC(C)c1cc(C(=O)NCCCCCC(=O)O)nc(C(=O)NCCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H27N3O7S/c1-12(2)13-10-14(17(24)19-7-5-3-4-6-16(22)23)21-15(11-13)18(25)20-8-9-29(26,27)28/h10-12H,3-9H2,1-2H3,(H,19,24)(H,20,25)(H,22,23)(H,26,27,28) |
| InChIKey | OOSHVYYPRYRIGH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 162.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|