C22H24O6 — CID 146227092
[(5R,13R)-10-acetyloxy-14-oxo-12-oxatetracyclo[9.6.1.01,13.07,18]octadeca-7(18),8,10,15-tetraen-5-yl]methyl acetate (PubChem CID 146227092) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is [(5R,13R)-10-acetyloxy-14-oxo-12-oxatetracyclo[9.6.1.01,13.07,18]octadeca-7(18),8,10,15-tetraen-5-yl]methyl acetate.
| Compound Name | [(5R,13R)-10-acetyloxy-14-oxo-12-oxatetracyclo[9.6.1.01,13.07,18]octadeca-7(18),8,10,15-tetraen-5-yl]methyl acetate |
|---|---|
| PubChem CID | 146227092 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [(5R,13R)-10-acetyloxy-14-oxo-12-oxatetracyclo[9.6.1.01,13.07,18]octadeca-7(18),8,10,15-tetraen-5-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CCCC23CC=CC(=O)[C@@H]2Oc2c(OC(C)=O)ccc(c23)C1 |
| InChI | InChI=1S/C22H24O6/c1-13(23)26-12-15-5-3-9-22-10-4-6-17(25)21(22)28-20-18(27-14(2)24)8-7-16(11-15)19(20)22/h4,6-8,15,21H,3,5,9-12H2,1-2H3/t15-,21+,22?/m1/s1 |
| InChIKey | DUIWSGWXOZXCRQ-XLRMLUQGSA-N |
| XLogP | 3.05 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|