C24H32BrClN2O7 — CID 146247992
tert-butyl 3-[[4-bromo-5-chloro-2-(1,5-dioxo-5-propanoyloxypentan-2-yl)oxy-N-methylanilino]methyl]azetidine-1-carboxylate (PubChem CID 146247992) has the molecular formula C24H32BrClN2O7 and a molecular weight of 575.88 g/mol. Its IUPAC name is tert-butyl 3-[[4-bromo-5-chloro-2-(1,5-dioxo-5-propanoyloxypentan-2-yl)oxy-N-methylanilino]methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-bromo-5-chloro-2-(1,5-dioxo-5-propanoyloxypentan-2-yl)oxy-N-methylanilino]methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 146247992 |
| Molecular Formula | C24H32BrClN2O7 |
| Molecular Weight | 575.88 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | tert-butyl 3-[[4-bromo-5-chloro-2-(1,5-dioxo-5-propanoyloxypentan-2-yl)oxy-N-methylanilino]methyl]azetidine-1-carboxylate |
| SMILES | CCC(=O)OC(=O)CCC(C=O)Oc1cc(Br)c(Cl)cc1N(C)CC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H32BrClN2O7/c1-6-21(30)34-22(31)8-7-16(14-29)33-20-9-17(25)18(26)10-19(20)27(5)11-15-12-28(13-15)23(32)35-24(2,3)4/h9-10,14-16H,6-8,11-13H2,1-5H3 |
| InChIKey | OIOJNNGPKZJHSP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.88 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|