C11H16N2O4 — CID 146260497
methyl (Z)-2-imino-5-(oxan-2-ylamino)-5-oxopent-3-enoate (PubChem CID 146260497) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is methyl (Z)-2-imino-5-(oxan-2-ylamino)-5-oxopent-3-enoate.
| Compound Name | methyl (Z)-2-imino-5-(oxan-2-ylamino)-5-oxopent-3-enoate |
|---|---|
| PubChem CID | 146260497 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | methyl (Z)-2-imino-5-(oxan-2-ylamino)-5-oxopent-3-enoate |
| SMILES | [H]/N=C(/C=C\C(=O)NC1CCCCO1)C(=O)OC |
| InChI | InChI=1S/C11H16N2O4/c1-16-11(15)8(12)5-6-9(14)13-10-4-2-3-7-17-10/h5-6,10,12H,2-4,7H2,1H3,(H,13,14)/b6-5-,12-8- |
| InChIKey | BNWNMUNIIQWNNR-BHLOCZDVSA-N |
| XLogP | 0.38 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|